 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N\C(=C\c1[nH]ccc1)\C(=O)NCCC1[NH+](CCC1)C)c1ccccc1 |
| InChI: | InChI=1/C21H26N4O2/c1-25-14-6-10-18(25)11-13-23-21(27)19(15-17-9-5-12-22-17)24-20(26)16-7-3-2-4-8-16/h2-5,7-9,12,15,18,22H,6,10-11,13-14H2,1H3,(H,23,27)(H,24,26)/p+1/b19-15-/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=55.7762 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 367.473 g/mol | logS: -3.26664 | SlogP: 0.969 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.065588 | Sterimol/B1: 2.17573 | Sterimol/B2: 5.1576 | Sterimol/B3: 5.83538 | |||
| Sterimol/B4: 7.20379 | Sterimol/L: 17.2509 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 672.285 | Positive charged surface: 467.253 | Negative charged surface: 205.032 | Volume: 373.375 | |||
| Hydrophobic surface: 521.699 | Hydrophilic surface: 150.586 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
