 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N\C(=C\c1[nH]ccc1)\C(=O)NCCC1N(CCC1)C)c1ccccc1 |
| InChI: | InChI=1/C21H26N4O2/c1-25-14-6-10-18(25)11-13-23-21(27)19(15-17-9-5-12-22-17)24-20(26)16-7-3-2-4-8-16/h2-5,7-9,12,15,18,22H,6,10-11,13-14H2,1H3,(H,23,27)(H,24,26)/b19-15-/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=118.522 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 366.465 g/mol | logS: -3.29103 | SlogP: 2.3861 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0338365 | Sterimol/B1: 2.87173 | Sterimol/B2: 3.77134 | Sterimol/B3: 5.24557 | |||
| Sterimol/B4: 7.09033 | Sterimol/L: 18.7493 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 658.213 | Positive charged surface: 426.723 | Negative charged surface: 231.49 | Volume: 367.5 | |||
| Hydrophobic surface: 562.291 | Hydrophilic surface: 95.922 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
