Type: Neutral
Formula: C23H28N2O3S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)NC1CCCc2c1cccc2)Cc1ccccc1 |
InChI: |
InChI=1/C23H28N2O3S/c26-23(24-22-14-6-11-19-10-4-5-13-21(19)22)20-12-7-15-25(16-20)29(27,28)17-18-8-2-1-3-9-18/h1-5,8-10,13,20,22H,6-7,11-12,14-17H2,(H,24,26)/t20-,22+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 412.554 g/mol | logS: -4.39267 | SlogP: 3.78407 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0746497 | Sterimol/B1: 3.24829 | Sterimol/B2: 4.005 | Sterimol/B3: 4.79316 |
Sterimol/B4: 6.1977 | Sterimol/L: 19.9072 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 680.539 | Positive charged surface: 437.827 | Negative charged surface: 242.711 | Volume: 393.25 |
Hydrophobic surface: 605.092 | Hydrophilic surface: 75.447 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |