Type: Neutral
Formula: C18H27N3O3
SMILES: |
O(CCCNC(=O)C1N(CCC1)C(=O)Nc1cc(ccc1)C)CC |
InChI: |
InChI=1/C18H27N3O3/c1-3-24-12-6-10-19-17(22)16-9-5-11-21(16)18(23)20-15-8-4-7-14(2)13-15/h4,7-8,13,16H,3,5-6,9-12H2,1-2H3,(H,19,22)(H,20,23)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 333.432 g/mol | logS: -3.19269 | SlogP: 2.53412 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0370326 | Sterimol/B1: 3.46355 | Sterimol/B2: 3.74448 | Sterimol/B3: 3.88272 |
Sterimol/B4: 8.27969 | Sterimol/L: 19.9141 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 662.578 | Positive charged surface: 494.156 | Negative charged surface: 168.423 | Volume: 339.25 |
Hydrophobic surface: 577.343 | Hydrophilic surface: 85.235 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |