Type: Neutral
Formula: C19H22N4O
SMILES: |
O=C(NCCCNc1nc2c(cc1C#N)cccc2C)C1CCC1 |
InChI: |
InChI=1/C19H22N4O/c1-13-5-2-8-15-11-16(12-20)18(23-17(13)15)21-9-4-10-22-19(24)14-6-3-7-14/h2,5,8,11,14H,3-4,6-7,9-10H2,1H3,(H,21,23)(H,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 322.412 g/mol | logS: -3.79096 | SlogP: 3.1332 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0187868 | Sterimol/B1: 2.36613 | Sterimol/B2: 2.7111 | Sterimol/B3: 3.12773 |
Sterimol/B4: 9.46958 | Sterimol/L: 19.0816 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.524 | Positive charged surface: 287.621 | Negative charged surface: 165.771 | Volume: 326.625 |
Hydrophobic surface: 485.344 | Hydrophilic surface: 140.18 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |