 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1C(C(=O)c2ccccc2)C(N(CCCCCC(=O)[O-])C1=O)c1ccc(cc1)C |
| InChI: | InChI=1/C24H25NO5/c1-16-11-13-17(14-12-16)21-20(22(28)18-8-4-2-5-9-18)23(29)24(30)25(21)15-7-3-6-10-19(26)27/h2,4-5,8-9,11-14,20-21H,3,6-7,10,15H2,1H3,(H,26,27)/p-1/t20-,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=61.3447 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.458 g/mol | logS: -4.97838 | SlogP: 2.35232 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.168306 | Sterimol/B1: 2.02017 | Sterimol/B2: 3.01531 | Sterimol/B3: 6.84991 | |||
| Sterimol/B4: 10.9982 | Sterimol/L: 18.4491 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 707.635 | Positive charged surface: 388.009 | Negative charged surface: 319.627 | Volume: 394.625 | |||
| Hydrophobic surface: 515.057 | Hydrophilic surface: 192.578 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
