 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1=C(C(=O)c2ccccc2)C(N(CCCCCC(O)=O)C1=O)c1ccc(cc1)C |
| InChI: | InChI=1/C24H25NO5/c1-16-11-13-17(14-12-16)21-20(22(28)18-8-4-2-5-9-18)23(29)24(30)25(21)15-7-3-6-10-19(26)27/h2,4-5,8-9,11-14,21,29H,3,6-7,10,15H2,1H3,(H,26,27)/t21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=67.9371 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 407.466 g/mol | logS: -4.81959 | SlogP: 4.31382 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.190169 | Sterimol/B1: 2.06295 | Sterimol/B2: 2.74227 | Sterimol/B3: 7.48886 | |||
| Sterimol/B4: 11.4882 | Sterimol/L: 17.4189 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 711.012 | Positive charged surface: 425.458 | Negative charged surface: 285.554 | Volume: 396.25 | |||
| Hydrophobic surface: 504.908 | Hydrophilic surface: 206.104 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
