Type: Neutral
Formula: C18H19N3O3S
SMILES: |
S(CC=C)C=1NC(=O)C2=C(NC(=O)CC2c2ccc(OCC)cc2)N=1 |
InChI: |
InChI=1/C18H19N3O3S/c1-3-9-25-18-20-16-15(17(23)21-18)13(10-14(22)19-16)11-5-7-12(8-6-11)24-4-2/h3,5-8,13H,1,4,9-10H2,2H3,(H2,19,20,21,22,23)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 357.434 g/mol | logS: -4.85987 | SlogP: 2.3054 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.11441 | Sterimol/B1: 2.41923 | Sterimol/B2: 4.00709 | Sterimol/B3: 5.44025 |
Sterimol/B4: 8.23017 | Sterimol/L: 17.0942 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 615.953 | Positive charged surface: 372.271 | Negative charged surface: 243.682 | Volume: 327.875 |
Hydrophobic surface: 343.98 | Hydrophilic surface: 271.973 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |