 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)C1C2C(N=C(C)C1C(=O)Nc1ncc(cc1)C)=CC(CC2=O)C |
| InChI: | InChI=1/C24H24ClN3O2/c1-13-4-9-20(26-12-13)28-24(30)21-15(3)27-18-10-14(2)11-19(29)23(18)22(21)16-5-7-17(25)8-6-16/h4-10,12,14,21-23H,11H2,1-3H3,(H,26,28,30)/t14-,21-,22-,23+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=97.2937 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.928 g/mol | logS: -4.66468 | SlogP: 4.96542 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.158686 | Sterimol/B1: 2.38637 | Sterimol/B2: 5.13123 | Sterimol/B3: 6.28435 | |||
| Sterimol/B4: 7.62655 | Sterimol/L: 17.0615 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 654.109 | Positive charged surface: 391.473 | Negative charged surface: 262.637 | Volume: 394.5 | |||
| Hydrophobic surface: 552.437 | Hydrophilic surface: 101.672 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
