Type: Neutral
Formula: C18H21N3O4S
SMILES: |
S(=O)(=O)(NCc1cccnc1)c1ccc(cc1)C(=O)NCC1OCCC1 |
InChI: |
InChI=1/C18H21N3O4S/c22-18(20-13-16-4-2-10-25-16)15-5-7-17(8-6-15)26(23,24)21-12-14-3-1-9-19-11-14/h1,3,5-9,11,16,21H,2,4,10,12-13H2,(H,20,22)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 375.449 g/mol | logS: -2.57377 | SlogP: 1.7353 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0649884 | Sterimol/B1: 2.25318 | Sterimol/B2: 2.48766 | Sterimol/B3: 5.74271 |
Sterimol/B4: 7.46206 | Sterimol/L: 19.8211 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 651.153 | Positive charged surface: 426.336 | Negative charged surface: 224.816 | Volume: 340.125 |
Hydrophobic surface: 499.247 | Hydrophilic surface: 151.906 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |