Type: Neutral
Formula: C13H20N4O3S
SMILES: |
s1ccnc1NC(=O)CN1CCC(NC(=O)COC)CC1 |
InChI: |
InChI=1/C13H20N4O3S/c1-20-9-12(19)15-10-2-5-17(6-3-10)8-11(18)16-13-14-4-7-21-13/h4,7,10H,2-3,5-6,8-9H2,1H3,(H,15,19)(H,14,16,18) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.394 g/mol | logS: -1.82382 | SlogP: 0.3086 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0289197 | Sterimol/B1: 2.95666 | Sterimol/B2: 3.35624 | Sterimol/B3: 3.5368 |
Sterimol/B4: 6.31216 | Sterimol/L: 19.4715 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 568.906 | Positive charged surface: 435.678 | Negative charged surface: 133.229 | Volume: 284.875 |
Hydrophobic surface: 444.179 | Hydrophilic surface: 124.727 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|