Type: Neutral
Formula: C17H25N3O3
SMILES: |
O=C(NC(Cc1ccccc1)C(=O)N)C(NC(=O)C)CC(C)C |
InChI: |
InChI=1/C17H25N3O3/c1-11(2)9-15(19-12(3)21)17(23)20-14(16(18)22)10-13-7-5-4-6-8-13/h4-8,11,14-15H,9-10H2,1-3H3,(H2,18,22)(H,19,21)(H,20,23)/t14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 319.405 g/mol | logS: -3.61039 | SlogP: 0.74997 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.208067 | Sterimol/B1: 1.969 | Sterimol/B2: 4.22482 | Sterimol/B3: 6.3338 |
Sterimol/B4: 7.07334 | Sterimol/L: 12.1122 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 577.516 | Positive charged surface: 365.845 | Negative charged surface: 211.671 | Volume: 321 |
Hydrophobic surface: 384.259 | Hydrophilic surface: 193.257 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |