 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)CN1C2CC(NC(=O)c3ccccc3C)CC1CCC2 |
| InChI: | InChI=1/C23H27ClN2O/c1-16-5-2-3-8-22(16)23(27)25-19-13-20-6-4-7-21(14-19)26(20)15-17-9-11-18(24)12-10-17/h2-3,5,8-12,19-21H,4,6-7,13-15H2,1H3,(H,25,27)/t19-,20-,21+ |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=87.8831 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 382.935 g/mol | logS: -5.71154 | SlogP: 5.23032 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.135556 | Sterimol/B1: 2.32331 | Sterimol/B2: 5.07115 | Sterimol/B3: 5.79825 | |||
| Sterimol/B4: 6.27763 | Sterimol/L: 17.2269 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 640.975 | Positive charged surface: 381.917 | Negative charged surface: 259.057 | Volume: 378.625 | |||
| Hydrophobic surface: 614.705 | Hydrophilic surface: 26.27 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
