Type: Neutral
Formula: C15H20ClNO6
SMILES: |
Clc1ccccc1COC1OC(CO)C(O)C(O)C1NC(=O)C |
InChI: |
InChI=1/C15H20ClNO6/c1-8(19)17-12-14(21)13(20)11(6-18)23-15(12)22-7-9-4-2-3-5-10(9)16/h2-5,11-15,18,20-21H,6-7H2,1H3,(H,17,19)/t11-,12+,13+,14+,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 345.779 g/mol | logS: -1.97989 | SlogP: 0.0667 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.141978 | Sterimol/B1: 2.47827 | Sterimol/B2: 2.57621 | Sterimol/B3: 5.41688 |
Sterimol/B4: 9.35659 | Sterimol/L: 13.9324 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 573.606 | Positive charged surface: 348.771 | Negative charged surface: 224.835 | Volume: 305 |
Hydrophobic surface: 408.845 | Hydrophilic surface: 164.761 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |