Type: Neutral
Formula: C19H28N4O4
SMILES: |
O(CCNC(=O)CN(C(=O)CCC(=O)Nc1ncccc1)C1CCCC1)C |
InChI: |
InChI=1/C19H28N4O4/c1-27-13-12-21-18(25)14-23(15-6-2-3-7-15)19(26)10-9-17(24)22-16-8-4-5-11-20-16/h4-5,8,11,15H,2-3,6-7,9-10,12-14H2,1H3,(H,21,25)(H,20,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 376.457 g/mol | logS: -1.74164 | SlogP: 1.3341 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0366668 | Sterimol/B1: 2.98423 | Sterimol/B2: 3.51335 | Sterimol/B3: 3.51488 |
Sterimol/B4: 7.93016 | Sterimol/L: 21.4852 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 705.734 | Positive charged surface: 544.493 | Negative charged surface: 161.241 | Volume: 367.25 |
Hydrophobic surface: 575.323 | Hydrophilic surface: 130.411 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |