 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)CN(C(=O)CCC(=O)Nc1ncccc1)c1ccccc1C |
| InChI: | InChI=1/C23H28N4O4/c1-17-7-2-3-9-19(17)27(16-22(29)25-15-18-8-6-14-31-18)23(30)12-11-21(28)26-20-10-4-5-13-24-20/h2-5,7,9-10,13,18H,6,8,11-12,14-16H2,1H3,(H,25,29)(H,24,26,28)/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=100.904 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 424.501 g/mol | logS: -3.32243 | SlogP: 2.43712 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0603748 | Sterimol/B1: 2.01616 | Sterimol/B2: 3.81578 | Sterimol/B3: 6.76297 | |||
| Sterimol/B4: 8.71663 | Sterimol/L: 21.4056 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 750.731 | Positive charged surface: 531.727 | Negative charged surface: 219.004 | Volume: 412.625 | |||
| Hydrophobic surface: 625.526 | Hydrophilic surface: 125.205 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.