 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1(=O)C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(N)c1ccccc1 |
| InChI: | InChI=1/C16H19N3O5S/c1-16(2)11(15(22)23)19-13(21)10(14(19)25(16)24)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/p-1/t9-,10-,11+,14+,25+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=101.309 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 364.402 g/mol | logS: -2.63872 | SlogP: -1.9056 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.114537 | Sterimol/B1: 2.63337 | Sterimol/B2: 4.53981 | Sterimol/B3: 5.08495 | |||
| Sterimol/B4: 6.1932 | Sterimol/L: 14.526 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 587.799 | Positive charged surface: 298.585 | Negative charged surface: 266.212 | Volume: 319.75 | |||
| Hydrophobic surface: 326.833 | Hydrophilic surface: 260.966 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
