 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)/C(/NC(=O)c1ccc(cc1)C)=C/C=C/c1ccccc1 |
| InChI: | InChI=1/C24H26N2O3/c1-18-12-14-20(15-13-18)23(27)26-22(11-5-9-19-7-3-2-4-8-19)24(28)25-17-21-10-6-16-29-21/h2-5,7-9,11-15,21H,6,10,16-17H2,1H3,(H,25,28)(H,26,27)/b9-5+,22-11+/t21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=113.367 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 390.483 g/mol | logS: -6.03106 | SlogP: 3.61732 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0358241 | Sterimol/B1: 3.62084 | Sterimol/B2: 4.00186 | Sterimol/B3: 4.23322 | |||
| Sterimol/B4: 9.96125 | Sterimol/L: 19.8144 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 731.197 | Positive charged surface: 447.003 | Negative charged surface: 284.194 | Volume: 394.875 | |||
| Hydrophobic surface: 661.865 | Hydrophilic surface: 69.332 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.