Type: Neutral
Formula: C12H22N4O4S
SMILES: |
S1CC(NC(=O)N)C(NC(=O)N)C1CCCCC(OC)=O |
InChI: |
InChI=1/C12H22N4O4S/c1-20-9(17)5-3-2-4-8-10(16-12(14)19)7(6-21-8)15-11(13)18/h7-8,10H,2-6H2,1H3,(H3,13,15,18)(H3,14,16,19)/t7-,8+,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.398 g/mol | logS: -1.86622 | SlogP: -0.091 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0394578 | Sterimol/B1: 3.0208 | Sterimol/B2: 3.63674 | Sterimol/B3: 4.23578 |
Sterimol/B4: 5.69891 | Sterimol/L: 19.0715 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 574.433 | Positive charged surface: 424.713 | Negative charged surface: 149.721 | Volume: 288.625 |
Hydrophobic surface: 275.249 | Hydrophilic surface: 299.184 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |