 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCC(N1C2NC(=O)NC2NC1=O)C(O)=O)C |
| InChI: | InChI=1/C9H14N4O4S/c1-18-3-2-4(7(14)15)13-6-5(11-9(13)17)10-8(16)12-6/h4-6H,2-3H2,1H3,(H,11,17)(H,14,15)(H2,10,12,16)/t4-,5+,6+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=41.124 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 274.301 g/mol | logS: -0.76076 | SlogP: -0.8171 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.206799 | Sterimol/B1: 2.41466 | Sterimol/B2: 3.87409 | Sterimol/B3: 3.9847 | |||
| Sterimol/B4: 8.03448 | Sterimol/L: 12.0604 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 462.976 | Positive charged surface: 283.371 | Negative charged surface: 179.605 | Volume: 227.625 | |||
| Hydrophobic surface: 159.412 | Hydrophilic surface: 303.564 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
