 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(Cc2ccccc2)C(=O)NC2CCCCC2)C(=O)C2C1C1CC2CC1 |
| InChI: | InChI=1/C24H30N2O3/c27-22(25-18-9-5-2-6-10-18)19(13-15-7-3-1-4-8-15)26-23(28)20-16-11-12-17(14-16)21(20)24(26)29/h1,3-4,7-8,16-21H,2,5-6,9-14H2,(H,25,27)/t16-,17+,19-,20-,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=95.4972 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 394.515 g/mol | logS: -5.17531 | SlogP: 3.07767 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.114797 | Sterimol/B1: 2.66197 | Sterimol/B2: 3.68465 | Sterimol/B3: 4.07557 | |||
| Sterimol/B4: 10.4757 | Sterimol/L: 15.2488 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 641.793 | Positive charged surface: 443.547 | Negative charged surface: 198.246 | Volume: 388.25 | |||
| Hydrophobic surface: 583.132 | Hydrophilic surface: 58.661 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.