 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1(=O)C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)Cc1ccccc1 |
| InChI: | InChI=1/C16H18N2O5S/c1-16(2)12(15(21)22)18-13(20)11(14(18)24(16)23)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22)/t11-,12-,14-,24+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=167.152 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 350.395 g/mol | logS: -2.74838 | SlogP: -0.12373 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.113258 | Sterimol/B1: 3.33777 | Sterimol/B2: 3.65819 | Sterimol/B3: 5.15978 | |||
| Sterimol/B4: 5.33352 | Sterimol/L: 15.1764 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 540.552 | Positive charged surface: 286.867 | Negative charged surface: 217.227 | Volume: 301.375 | |||
| Hydrophobic surface: 341.748 | Hydrophilic surface: 198.804 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
