 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1cc(ccc1)C)C(=O)NCC1N(CCC1)CC |
| InChI: | InChI=1/C16H23N3O2/c1-3-19-9-5-8-14(19)11-17-15(20)16(21)18-13-7-4-6-12(2)10-13/h4,6-7,10,14H,3,5,8-9,11H2,1-2H3,(H,17,20)(H,18,21)/t14-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=86.4745 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 289.379 g/mol | logS: -3.01094 | SlogP: 1.53402 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0184283 | Sterimol/B1: 2.46457 | Sterimol/B2: 2.69959 | Sterimol/B3: 3.2617 | |||
| Sterimol/B4: 6.49715 | Sterimol/L: 17.7438 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 570.942 | Positive charged surface: 392.017 | Negative charged surface: 178.925 | Volume: 292.75 | |||
| Hydrophobic surface: 452.111 | Hydrophilic surface: 118.831 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
