 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1cccc1C1C2C(=NC(=C)C1C(=O)Nc1ncc(cc1)C)CC(CC2=O)C |
| InChI: | InChI=1/C22H23N3O2S/c1-12-6-7-18(23-11-12)25-22(27)19-14(3)24-15-9-13(2)10-16(26)20(15)21(19)17-5-4-8-28-17/h4-8,11,13,19-21H,3,9-10H2,1-2H3,(H,23,25,27)/t13-,19-,20+,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.8039 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 393.511 g/mol | logS: -3.92188 | SlogP: 4.37352 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.183765 | Sterimol/B1: 2.93187 | Sterimol/B2: 3.10613 | Sterimol/B3: 6.87295 | |||
| Sterimol/B4: 8.61829 | Sterimol/L: 16.4373 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 633.716 | Positive charged surface: 396.556 | Negative charged surface: 237.16 | Volume: 372.375 | |||
| Hydrophobic surface: 523.226 | Hydrophilic surface: 110.49 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
