 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccc(cc1)C1C2C(N=C(C)C1C(=O)Nc1ncc(cc1)C)=CC(CC2=O)C |
| InChI: | InChI=1/C24H24FN3O2/c1-13-4-9-20(26-12-13)28-24(30)21-15(3)27-18-10-14(2)11-19(29)23(18)22(21)16-5-7-17(25)8-6-16/h4-10,12,14,21-23H,11H2,1-3H3,(H,26,28,30)/t14-,21+,22+,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=87.5585 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.473 g/mol | logS: -4.22537 | SlogP: 4.45112 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.217032 | Sterimol/B1: 2.87662 | Sterimol/B2: 4.05727 | Sterimol/B3: 6.72947 | |||
| Sterimol/B4: 7.49826 | Sterimol/L: 16.2859 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 635.808 | Positive charged surface: 412.878 | Negative charged surface: 222.93 | Volume: 383.875 | |||
| Hydrophobic surface: 551.053 | Hydrophilic surface: 84.755 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
