Type: Neutral
Formula: C16H22N2O4
SMILES: |
O1CCCC1CNC(=O)C(NC(OCc1ccccc1)=O)C |
InChI: |
InChI=1/C16H22N2O4/c1-12(15(19)17-10-14-8-5-9-21-14)18-16(20)22-11-13-6-3-2-4-7-13/h2-4,6-7,12,14H,5,8-11H2,1H3,(H,17,19)(H,18,20)/t12-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 306.362 g/mol | logS: -2.80263 | SlogP: 1.8629 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0294463 | Sterimol/B1: 2.18571 | Sterimol/B2: 3.29151 | Sterimol/B3: 3.65721 |
Sterimol/B4: 6.26579 | Sterimol/L: 20.101 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 608.367 | Positive charged surface: 418.899 | Negative charged surface: 189.468 | Volume: 299.875 |
Hydrophobic surface: 476.652 | Hydrophilic surface: 131.715 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |