Type: Neutral
Formula: C14H27N3O4
SMILES: |
O(C(C)(C)C)C(=O)NC(C(=O)NC(C(CC)C)C(=O)N)C |
InChI: |
InChI=1/C14H27N3O4/c1-7-8(2)10(11(15)18)17-12(19)9(3)16-13(20)21-14(4,5)6/h8-10H,7H2,1-6H3,(H2,15,18)(H,16,20)(H,17,19)/t8-,9+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 301.387 g/mol | logS: -2.84587 | SlogP: 0.9158 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0643884 | Sterimol/B1: 2.51612 | Sterimol/B2: 2.78724 | Sterimol/B3: 5.0423 |
Sterimol/B4: 6.41283 | Sterimol/L: 17.0013 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 581.555 | Positive charged surface: 392.605 | Negative charged surface: 188.95 | Volume: 300.875 |
Hydrophobic surface: 312.525 | Hydrophilic surface: 269.03 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |