Type: Neutral
Formula: C21H29N3O3S
SMILES: |
S=C(N(CC1=Cc2c(NC1=O)c(C)c(cc2)C)CCCO)NCC1OCCC1 |
InChI: |
InChI=1/C21H29N3O3S/c1-14-6-7-16-11-17(20(26)23-19(16)15(14)2)13-24(8-4-9-25)21(28)22-12-18-5-3-10-27-18/h6-7,11,18,25H,3-5,8-10,12-13H2,1-2H3,(H,22,28)(H,23,26)/t18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 403.547 g/mol | logS: -4.9148 | SlogP: 2.37684 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.110229 | Sterimol/B1: 3.61274 | Sterimol/B2: 3.86302 | Sterimol/B3: 5.71477 |
Sterimol/B4: 8.98035 | Sterimol/L: 16.913 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 697.942 | Positive charged surface: 486.365 | Negative charged surface: 211.577 | Volume: 390.625 |
Hydrophobic surface: 536.023 | Hydrophilic surface: 161.919 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |