Type: Neutral
Formula: C16H17BrN4O2
SMILES: |
Brc1cc(ccc1)C1=NOC(C1)C(=O)NCCCn1ccnc1 |
InChI: |
InChI=1/C16H17BrN4O2/c17-13-4-1-3-12(9-13)14-10-15(23-20-14)16(22)19-5-2-7-21-8-6-18-11-21/h1,3-4,6,8-9,11,15H,2,5,7,10H2,(H,19,22)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 377.242 g/mol | logS: -3.7054 | SlogP: 2.6115 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0265864 | Sterimol/B1: 3.17719 | Sterimol/B2: 3.28173 | Sterimol/B3: 4.89817 |
Sterimol/B4: 5.93367 | Sterimol/L: 18.9266 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 619.074 | Positive charged surface: 355.229 | Negative charged surface: 263.845 | Volume: 319 |
Hydrophobic surface: 487.906 | Hydrophilic surface: 131.168 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |