Type: Neutral
Formula: C16H16F3N3O3
SMILES: |
FC(F)(F)C1(NC(=O)N(C(C)c2ccccc2)C1=O)NC(=O)C1CC1 |
InChI: |
InChI=1/C16H16F3N3O3/c1-9(10-5-3-2-4-6-10)22-13(24)15(16(17,18)19,21-14(22)25)20-12(23)11-7-8-11/h2-6,9,11H,7-8H2,1H3,(H,20,23)(H,21,25)/t9-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 355.316 g/mol | logS: -3.74998 | SlogP: 2.5996 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0987627 | Sterimol/B1: 2.76021 | Sterimol/B2: 3.07105 | Sterimol/B3: 4.75258 |
Sterimol/B4: 7.04394 | Sterimol/L: 14.9934 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 537.303 | Positive charged surface: 273.228 | Negative charged surface: 264.074 | Volume: 295.375 |
Hydrophobic surface: 303.769 | Hydrophilic surface: 233.534 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |