Type: Neutral
Formula: C19H23N3O5
SMILES: |
o1nc(NC(=O)COC(=O)C(NC(=O)c2ccccc2)CC(C)C)cc1C |
InChI: |
InChI=1/C19H23N3O5/c1-12(2)9-15(20-18(24)14-7-5-4-6-8-14)19(25)26-11-17(23)21-16-10-13(3)27-22-16/h4-8,10,12,15H,9,11H2,1-3H3,(H,20,24)(H,21,22,23)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 373.409 g/mol | logS: -4.76603 | SlogP: 2.30942 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.035732 | Sterimol/B1: 2.68004 | Sterimol/B2: 4.57673 | Sterimol/B3: 4.69155 |
Sterimol/B4: 5.64959 | Sterimol/L: 20.8233 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 672.928 | Positive charged surface: 399.077 | Negative charged surface: 273.851 | Volume: 351.125 |
Hydrophobic surface: 492.175 | Hydrophilic surface: 180.753 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |