Type: Neutral
Formula: C22H27ClN2O2S
SMILES: |
Clc1ccccc1C(=O)Nc1sc2c(CCCC2)c1C(=O)N(CCC)CCC |
InChI: |
InChI=1/C22H27ClN2O2S/c1-3-13-25(14-4-2)22(27)19-16-10-6-8-12-18(16)28-21(19)24-20(26)15-9-5-7-11-17(15)23/h5,7,9,11H,3-4,6,8,10,12-14H2,1-2H3,(H,24,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 418.989 g/mol | logS: -6.24108 | SlogP: 5.79474 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.158827 | Sterimol/B1: 2.08548 | Sterimol/B2: 6.3382 | Sterimol/B3: 7.0092 |
Sterimol/B4: 7.26733 | Sterimol/L: 15.9039 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 674.31 | Positive charged surface: 416.688 | Negative charged surface: 257.622 | Volume: 402.75 |
Hydrophobic surface: 589.925 | Hydrophilic surface: 84.385 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |