Type: Neutral
Formula: C21H27N3O5
SMILES: |
o1nc(NC(=O)C(OC(=O)C(NC(=O)c2ccccc2)CC(C)C)CC)cc1C |
InChI: |
InChI=1/C21H27N3O5/c1-5-17(20(26)23-18-12-14(4)29-24-18)28-21(27)16(11-13(2)3)22-19(25)15-9-7-6-8-10-15/h6-10,12-13,16-17H,5,11H2,1-4H3,(H,22,25)(H,23,24,26)/t16-,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 401.463 g/mol | logS: -5.29501 | SlogP: 3.08802 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0662949 | Sterimol/B1: 2.19125 | Sterimol/B2: 2.36695 | Sterimol/B3: 5.65033 |
Sterimol/B4: 8.97051 | Sterimol/L: 20.6924 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 709.16 | Positive charged surface: 419.477 | Negative charged surface: 289.683 | Volume: 385.25 |
Hydrophobic surface: 534.721 | Hydrophilic surface: 174.439 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |