Type: Neutral
Formula: C16H21N2O4+
SMILES: |
O1C(=O)C(CC1(C(=O)C[n+]1cc(ccc1)C(=O)N)C)CCC |
InChI: |
InChI=1/C16H20N2O4/c1-3-5-11-8-16(2,22-15(11)21)13(19)10-18-7-4-6-12(9-18)14(17)20/h4,6-7,9,11H,3,5,8,10H2,1-2H3,(H-,17,20)/p+1/t11-,16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.354 g/mol | logS: -2.77995 | SlogP: 1.0304 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0503919 | Sterimol/B1: 2.62079 | Sterimol/B2: 3.45466 | Sterimol/B3: 3.81321 |
Sterimol/B4: 7.50029 | Sterimol/L: 15.7715 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 559.929 | Positive charged surface: 378.819 | Negative charged surface: 181.11 | Volume: 294.875 |
Hydrophobic surface: 320.852 | Hydrophilic surface: 239.077 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |