Type: Neutral
Formula: C19H19N3O4S2
SMILES: |
s1ccnc1NS(=O)(=O)c1ccc(NC(=O)CCCOc2ccccc2)cc1 |
InChI: |
InChI=1/C19H19N3O4S2/c23-18(7-4-13-26-16-5-2-1-3-6-16)21-15-8-10-17(11-9-15)28(24,25)22-19-20-12-14-27-19/h1-3,5-6,8-12,14H,4,7,13H2,(H,20,22)(H,21,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 417.51 g/mol | logS: -4.64859 | SlogP: 3.7416 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0190516 | Sterimol/B1: 3.29447 | Sterimol/B2: 3.89529 | Sterimol/B3: 4.37809 |
Sterimol/B4: 5.67056 | Sterimol/L: 22.0388 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 684.025 | Positive charged surface: 390.887 | Negative charged surface: 293.138 | Volume: 364.75 |
Hydrophobic surface: 518.465 | Hydrophilic surface: 165.56 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |