Type: Neutral
Formula: C15H21N3O4S
SMILES: |
S(CCC(NC(=O)CNC(=O)c1cccnc1)C(OCC)=O)C |
InChI: |
InChI=1/C15H21N3O4S/c1-3-22-15(21)12(6-8-23-2)18-13(19)10-17-14(20)11-5-4-7-16-9-11/h4-5,7,9,12H,3,6,8,10H2,1-2H3,(H,17,20)(H,18,19)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 339.416 g/mol | logS: -2.37447 | SlogP: 0.6124 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.051823 | Sterimol/B1: 2.49905 | Sterimol/B2: 3.11587 | Sterimol/B3: 4.00721 |
Sterimol/B4: 11.1722 | Sterimol/L: 17.3711 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 640.683 | Positive charged surface: 428.317 | Negative charged surface: 212.366 | Volume: 317.625 |
Hydrophobic surface: 449.227 | Hydrophilic surface: 191.456 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |