Type: Neutral
Formula: C18H22N4O
SMILES: |
O=C(Nc1cc(ccc1)CC)C1CCCN(C1)c1ncccn1 |
InChI: |
InChI=1/C18H22N4O/c1-2-14-6-3-8-16(12-14)21-17(23)15-7-4-11-22(13-15)18-19-9-5-10-20-18/h3,5-6,8-10,12,15H,2,4,7,11,13H2,1H3,(H,21,23)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.401 g/mol | logS: -4.11132 | SlogP: 2.89407 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0654609 | Sterimol/B1: 2.82357 | Sterimol/B2: 3.62663 | Sterimol/B3: 5.01294 |
Sterimol/B4: 7.16917 | Sterimol/L: 16.603 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 587.05 | Positive charged surface: 437.534 | Negative charged surface: 149.516 | Volume: 313.25 |
Hydrophobic surface: 501.601 | Hydrophilic surface: 85.449 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |