Type: Neutral
Formula: C21H26N2O4S2
SMILES: |
S(=O)(=O)(NC1CCCC1)c1ccc(S(=O)(=O)NC2CCCc3c2cccc3)cc1 |
InChI: |
InChI=1/C21H26N2O4S2/c24-28(25,22-17-8-2-3-9-17)18-12-14-19(15-13-18)29(26,27)23-21-11-5-7-16-6-1-4-10-20(16)21/h1,4,6,10,12-15,17,21-23H,2-3,5,7-9,11H2/t21-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 434.581 g/mol | logS: -4.68552 | SlogP: 3.35887 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0700529 | Sterimol/B1: 2.71279 | Sterimol/B2: 3.81911 | Sterimol/B3: 5.68814 |
Sterimol/B4: 5.75817 | Sterimol/L: 19.2534 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 672.331 | Positive charged surface: 394.727 | Negative charged surface: 277.604 | Volume: 390.5 |
Hydrophobic surface: 524.365 | Hydrophilic surface: 147.966 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |