 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N(CC(=O)NCC1OCCC1)c1cc(OC)ccc1)c1ccc(cc1)C |
| InChI: | InChI=1/C21H26N2O5S/c1-16-8-10-20(11-9-16)29(25,26)23(17-5-3-6-18(13-17)27-2)15-21(24)22-14-19-7-4-12-28-19/h3,5-6,8-11,13,19H,4,7,12,14-15H2,1-2H3,(H,22,24)/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=109.644 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 418.514 g/mol | logS: -4.51419 | SlogP: 2.49412 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0649689 | Sterimol/B1: 2.52628 | Sterimol/B2: 2.60124 | Sterimol/B3: 5.73433 | |||
| Sterimol/B4: 10.566 | Sterimol/L: 18.3431 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 705.363 | Positive charged surface: 466.819 | Negative charged surface: 238.544 | Volume: 386.5 | |||
| Hydrophobic surface: 598.278 | Hydrophilic surface: 107.085 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.