 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CN(CC1=Cc2c(NC1=O)c(C)c(cc2)C)C(=O)Nc1ccccc1 |
| InChI: | InChI=1/C24H27N3O3/c1-16-10-11-18-13-19(23(28)26-22(18)17(16)2)14-27(15-21-9-6-12-30-21)24(29)25-20-7-4-3-5-8-20/h3-5,7-8,10-11,13,21H,6,9,12,14-15H2,1-2H3,(H,25,29)(H,26,28)/t21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=80.2185 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.498 g/mol | logS: -5.28585 | SlogP: 4.35204 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0825113 | Sterimol/B1: 3.48966 | Sterimol/B2: 4.7306 | Sterimol/B3: 6.40711 | |||
| Sterimol/B4: 6.77463 | Sterimol/L: 16.926 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.28 | Positive charged surface: 458.43 | Negative charged surface: 237.85 | Volume: 399.25 | |||
| Hydrophobic surface: 624.061 | Hydrophilic surface: 72.219 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.