Type: Neutral
Formula: C18H19N3O4S2
SMILES: |
s1ccnc1NS(=O)(=O)c1ccc(NC(=O)CCc2oc(cc2)CC)cc1 |
InChI: |
InChI=1/C18H19N3O4S2/c1-2-14-5-6-15(25-14)7-10-17(22)20-13-3-8-16(9-4-13)27(23,24)21-18-19-11-12-26-18/h3-6,8-9,11-12H,2,7,10H2,1H3,(H,19,21)(H,20,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 405.499 g/mol | logS: -4.6982 | SlogP: 3.67054 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0369851 | Sterimol/B1: 2.9586 | Sterimol/B2: 4.80354 | Sterimol/B3: 5.12612 |
Sterimol/B4: 5.33946 | Sterimol/L: 21.0277 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 665.252 | Positive charged surface: 404.367 | Negative charged surface: 260.885 | Volume: 351.25 |
Hydrophobic surface: 477.916 | Hydrophilic surface: 187.336 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |