Type: Neutral
Formula: C15H19NO7
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1Oc1ccccc1C=O |
InChI: |
InChI=1/C15H19NO7/c1-8(19)16-12-14(21)13(20)11(7-18)23-15(12)22-10-5-3-2-4-9(10)6-17/h2-6,11-15,18,20-21H,7H2,1H3,(H,16,19)/t11-,12-,13-,14+,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 325.317 g/mol | logS: -1.18589 | SlogP: -1.1784 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.294451 | Sterimol/B1: 2.36354 | Sterimol/B2: 3.41018 | Sterimol/B3: 5.50472 |
Sterimol/B4: 7.97641 | Sterimol/L: 12.6517 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 529.306 | Positive charged surface: 358.204 | Negative charged surface: 171.103 | Volume: 287.5 |
Hydrophobic surface: 315.864 | Hydrophilic surface: 213.442 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |