Type: Neutral
Formula: C22H22N2O
SMILES: |
O=C(Nc1cc(ccc1C)C)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C22H22N2O/c1-14-11-12-15(2)20(13-14)24-22(25)21-16-7-3-5-9-18(16)23-19-10-6-4-8-17(19)21/h3,5,7,9,11-13H,4,6,8,10H2,1-2H3,(H,24,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.431 g/mol | logS: -5.66661 | SlogP: 4.98268 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.138909 | Sterimol/B1: 2.39412 | Sterimol/B2: 4.07855 | Sterimol/B3: 6.52681 |
Sterimol/B4: 7.92311 | Sterimol/L: 14.3062 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.855 | Positive charged surface: 368.197 | Negative charged surface: 216.563 | Volume: 336 |
Hydrophobic surface: 549.293 | Hydrophilic surface: 39.562 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |