 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1C2CC[NH+](C1)CC2)NC(C)(C)c1cc(ccc1)C(C)=C |
| InChI: | InChI=1/C20H29N3O/c1-14(2)16-6-5-7-17(12-16)20(3,4)22-19(24)21-18-13-23-10-8-15(18)9-11-23/h5-7,12,15,18H,1,8-11,13H2,2-4H3,(H2,21,22,24)/p+1/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=44.3419 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 328.48 g/mol | logS: -4.10479 | SlogP: 2.2426 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0931678 | Sterimol/B1: 3.27893 | Sterimol/B2: 3.54409 | Sterimol/B3: 4.49989 | |||
| Sterimol/B4: 7.60071 | Sterimol/L: 16.6015 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 624.392 | Positive charged surface: 461.154 | Negative charged surface: 163.238 | Volume: 354.125 | |||
| Hydrophobic surface: 488.71 | Hydrophilic surface: 135.682 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
