 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NCC1N2CC(C(C1)CC2)CC)c1cc2c(cc1)cccc2 |
| InChI: | InChI=1/C21H26N2O/c1-2-15-14-23-10-9-18(15)12-20(23)13-22-21(24)19-8-7-16-5-3-4-6-17(16)11-19/h3-8,11,15,18,20H,2,9-10,12-14H2,1H3,(H,22,24)/t15-,18-,20+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=89.1147 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 322.452 g/mol | logS: -5.00309 | SlogP: 3.69 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0741871 | Sterimol/B1: 2.32805 | Sterimol/B2: 2.51314 | Sterimol/B3: 5.3975 | |||
| Sterimol/B4: 7.47752 | Sterimol/L: 16.7831 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 591.858 | Positive charged surface: 393.584 | Negative charged surface: 187.111 | Volume: 333.25 | |||
| Hydrophobic surface: 532.302 | Hydrophilic surface: 59.556 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
