 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2cc(ccc2OC1)CNC(=O)C1C2CC([NH+](C1)CC2)Cn1nnc(c1)C1(O)CCC C1 |
| InChI: | InChI=1/C24H31N5O4/c30-23(25-11-16-3-4-20-21(9-16)33-15-32-20)19-13-28-8-5-17(19)10-18(28)12-29-14-22(26-27-29)24(31)6-1-2-7-24/h3-4,9,14,17-19,31H,1-2,5-8,10-13,15H2,(H,25,30)/p+1/t17-,18+,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=60.1256 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 454.551 g/mol | logS: -2.41815 | SlogP: 1.2224 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0985681 | Sterimol/B1: 3.51912 | Sterimol/B2: 4.6892 | Sterimol/B3: 6.23863 | |||
| Sterimol/B4: 8.23618 | Sterimol/L: 17.8099 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 736.717 | Positive charged surface: 551.812 | Negative charged surface: 184.906 | Volume: 431.625 | |||
| Hydrophobic surface: 563.966 | Hydrophilic surface: 172.751 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
