 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1nnn(c1)CC1N2CC(C(C1)CC2)C(=O)NC1CCCCC1)c1ccccc1 |
| InChI: | InChI=1/C24H33N5O2/c30-24(25-19-7-3-1-4-8-19)23-16-28-12-11-18(23)13-21(28)15-29-14-20(26-27-29)17-31-22-9-5-2-6-10-22/h2,5-6,9-10,14,18-19,21,23H,1,3-4,7-8,11-13,15-17H2,(H,25,30)/t18-,21+,23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=94.2175 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.561 g/mol | logS: -3.28202 | SlogP: 3.5492 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.114629 | Sterimol/B1: 2.79324 | Sterimol/B2: 5.0292 | Sterimol/B3: 6.04813 | |||
| Sterimol/B4: 7.8344 | Sterimol/L: 16.3364 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 720.108 | Positive charged surface: 505.483 | Negative charged surface: 214.625 | Volume: 420 | |||
| Hydrophobic surface: 626.038 | Hydrophilic surface: 94.07 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
