 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1cccc1CNC(=O)C1C2CC(N(C1)CC2)Cn1nnc(c1)COc1ccccc1 |
| InChI: | InChI=1/C23H27N5O3/c29-23(24-12-21-7-4-10-30-21)22-15-27-9-8-17(22)11-19(27)14-28-13-18(25-26-28)16-31-20-5-2-1-3-6-20/h1-7,10,13,17,19,22H,8-9,11-12,14-16H2,(H,24,29)/t17-,19+,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=97.7313 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.501 g/mol | logS: -3.33035 | SlogP: 3.2761 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0836665 | Sterimol/B1: 3.48219 | Sterimol/B2: 4.7562 | Sterimol/B3: 6.04007 | |||
| Sterimol/B4: 7.933 | Sterimol/L: 16.8187 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 722.238 | Positive charged surface: 451.96 | Negative charged surface: 270.277 | Volume: 402.25 | |||
| Hydrophobic surface: 608.668 | Hydrophilic surface: 113.57 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
