 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccccc1CNC(=O)C1C2CC([NH+](C1)CC2)Cn1nnc(c1)CO |
| InChI: | InChI=1/C20H27N5O3/c1-28-19-5-3-2-4-15(19)9-21-20(27)18-12-24-7-6-14(18)8-17(24)11-25-10-16(13-26)22-23-25/h2-5,10,14,17-18,26H,6-9,11-13H2,1H3,(H,21,27)/p+1/t14-,17-,18+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=50.502 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 386.476 g/mol | logS: -1.55751 | SlogP: 0.1879 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.107928 | Sterimol/B1: 2.26882 | Sterimol/B2: 4.69258 | Sterimol/B3: 5.41782 | |||
| Sterimol/B4: 7.17635 | Sterimol/L: 18.6741 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.399 | Positive charged surface: 510.758 | Negative charged surface: 166.641 | Volume: 376.375 | |||
| Hydrophobic surface: 511.311 | Hydrophilic surface: 166.088 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
