 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C2C(OCC2[NH2+]Cc2ccccc2)C(Nc2nc(ccn2)-c2cc3OCOc3cc2)C1 |
| InChI: | InChI=1/C24H24N4O4/c1-2-4-15(5-3-1)11-26-18-12-29-23-19(13-30-22(18)23)28-24-25-9-8-17(27-24)16-6-7-20-21(10-16)32-14-31-20/h1-10,18-19,22-23,26H,11-14H2,(H,25,27,28)/p+1/t18-,19-,22+,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=82.7378 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 433.488 g/mol | logS: -5.12963 | SlogP: 1.849 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0254854 | Sterimol/B1: 2.90463 | Sterimol/B2: 4.63002 | Sterimol/B3: 4.80554 | |||
| Sterimol/B4: 5.61518 | Sterimol/L: 23.398 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 739.622 | Positive charged surface: 519.495 | Negative charged surface: 215.399 | Volume: 408.75 | |||
| Hydrophobic surface: 592.024 | Hydrophilic surface: 147.598 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
